About 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol
3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol (PubChem CID 103887684) has the molecular formula C12H20F3N3O
and a molecular weight of 279.31 g/mol. Its IUPAC name is 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 103887684 |
| Molecular Formula | C12H20F3N3O |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol |
| SMILES | Cn1cc(CNCC(O)C(F)(F)F)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H20F3N3O/c1-11(2,3)10-8(7-18(4)17-10)5-16-6-9(19)12(13,14)15/h7,9,16,19H,5-6H2,1-4H3 |
| InChIKey | GOQVQFPCQAFHMH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol (CID 103887684) is 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol is Cn1cc(CNCC(O)C(F)(F)F)c(C(C)(C)C)n1.
What is the InChIKey of 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol?
The InChIKey is GOQVQFPCQAFHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N3O/c1-11(2,3)10-8(7-18(4)17-10)5-16-6-9(19)12(13,14)15/h7,9,16,19H,5-6H2,1-4H3.
What are the key properties of 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol?
3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol has a molecular weight of 279.31 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 103887684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).