C12H12ClN3O2S — CID 103888375
6-chloro-4-nitro-N-(1-thiophen-2-ylpropan-2-yl)pyridin-2-amine (PubChem CID 103888375) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is 6-chloro-4-nitro-N-(1-thiophen-2-ylpropan-2-yl)pyridin-2-amine.
| Compound Name | 6-chloro-4-nitro-N-(1-thiophen-2-ylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 103888375 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 6-chloro-4-nitro-N-(1-thiophen-2-ylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(Cc1cccs1)Nc1cc([N+](=O)[O-])cc(Cl)n1 |
| InChI | InChI=1S/C12H12ClN3O2S/c1-8(5-10-3-2-4-19-10)14-12-7-9(16(17)18)6-11(13)15-12/h2-4,6-8H,5H2,1H3,(H,14,15) |
| InChIKey | QGPLAZFQLBZUPW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|