C15H25N3OS — CID 103888844
3-[(3-ethylsulfanylcyclopentyl)amino]-1-(2-methylpropyl)pyrazin-2-one (PubChem CID 103888844) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 3-[(3-ethylsulfanylcyclopentyl)amino]-1-(2-methylpropyl)pyrazin-2-one.
| Compound Name | 3-[(3-ethylsulfanylcyclopentyl)amino]-1-(2-methylpropyl)pyrazin-2-one |
|---|---|
| PubChem CID | 103888844 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-[(3-ethylsulfanylcyclopentyl)amino]-1-(2-methylpropyl)pyrazin-2-one |
| SMILES | CCSC1CCC(Nc2nccn(CC(C)C)c2=O)C1 |
| InChI | InChI=1S/C15H25N3OS/c1-4-20-13-6-5-12(9-13)17-14-15(19)18(8-7-16-14)10-11(2)3/h7-8,11-13H,4-6,9-10H2,1-3H3,(H,16,17) |
| InChIKey | PRFUNQMNMRKIGJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |