C23H47FO3Si2 — CID 10388895
[(4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohexen-1-yl]methanol (PubChem CID 10388895) has the molecular formula C23H47FO3Si2 and a molecular weight of 446.80 g/mol. Its IUPAC name is [(4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohexen-1-yl]methanol.
| Compound Name | [(4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 10388895 |
| Molecular Formula | C23H47FO3Si2 |
| Molecular Weight | 446.80 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | [(4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohexen-1-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(CO)=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCCCF |
| InChI | InChI=1S/C23H47FO3Si2/c1-22(2,3)28(7,8)26-20-15-14-18(17-25)21(19(20)13-11-12-16-24)27-29(9,10)23(4,5)6/h14,19-21,25H,11-13,15-17H2,1-10H3/t19-,20+,21+/m0/s1 |
| InChIKey | NHRHZGSTBIVZBF-PWRODBHTSA-N |
| XLogP | 6.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.80 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|