C13H17BrN2O2 — CID 103890092
6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide (PubChem CID 103890092) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103890092 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2cccc(Br)n2)CCO1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-13(2)8-9(6-7-18-13)15-12(17)10-4-3-5-11(14)16-10/h3-5,9H,6-8H2,1-2H3,(H,15,17) |
| InChIKey | CWTFXFCTJSYURP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|