About 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide
6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide (PubChem CID 103890092) has the molecular formula C13H17BrN2O2
and a molecular weight of 313.19 g/mol. Its IUPAC name is 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide |
| PubChem CID | 103890092 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2cccc(Br)n2)CCO1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-13(2)8-9(6-7-18-13)15-12(17)10-4-3-5-11(14)16-10/h3-5,9H,6-8H2,1-2H3,(H,15,17) |
| InChIKey | CWTFXFCTJSYURP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide?
The IUPAC name of 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide (CID 103890092) is 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide.
What is the SMILES notation for 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide?
The canonical SMILES for 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide is CC1(C)CC(NC(=O)c2cccc(Br)n2)CCO1.
What is the InChIKey of 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide?
The InChIKey is CWTFXFCTJSYURP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrN2O2/c1-13(2)8-9(6-7-18-13)15-12(17)10-4-3-5-11(14)16-10/h3-5,9H,6-8H2,1-2H3,(H,15,17).
What are the key properties of 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide?
6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide has a molecular weight of 313.19 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-(2,2-dimethyloxan-4-yl)pyridine-2-carboxamide is sourced from PubChem (CID 103890092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).