C7H2Br4N2O — CID 10389037
4,5,6,7-tetrabromo-1,3-dihydrobenzimidazol-2-one (PubChem CID 10389037) has the molecular formula C7H2Br4N2O and a molecular weight of 449.72 g/mol. Its IUPAC name is 4,5,6,7-tetrabromo-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 4,5,6,7-tetrabromo-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 10389037 |
| Molecular Formula | C7H2Br4N2O |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 445.69 |
| IUPAC Name | 4,5,6,7-tetrabromo-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2c(Br)c(Br)c(Br)c(Br)c2[nH]1 |
| InChI | InChI=1S/C7H2Br4N2O/c8-1-2(9)4(11)6-5(3(1)10)12-7(14)13-6/h(H2,12,13,14) |
| InChIKey | BMVNFJCUHHTZQU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|