C13H17NO4 — CID 103890430
(2,6-dihydroxyphenyl)-(2-methyl-1,4-oxazepan-4-yl)methanone (PubChem CID 103890430) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (2,6-dihydroxyphenyl)-(2-methyl-1,4-oxazepan-4-yl)methanone.
| Compound Name | (2,6-dihydroxyphenyl)-(2-methyl-1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 103890430 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2,6-dihydroxyphenyl)-(2-methyl-1,4-oxazepan-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2c(O)cccc2O)CCCO1 |
| InChI | InChI=1S/C13H17NO4/c1-9-8-14(6-3-7-18-9)13(17)12-10(15)4-2-5-11(12)16/h2,4-5,9,15-16H,3,6-8H2,1H3 |
| InChIKey | IYIQENJDFFCPIO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |