About N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 103890787) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| PubChem CID | 103890787 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | CCC(CO)(CO)NC(=O)c1oc(C)nc1C |
| InChI | InChI=1S/C11H18N2O4/c1-4-11(5-14,6-15)13-10(16)9-7(2)12-8(3)17-9/h14-15H,4-6H2,1-3H3,(H,13,16) |
| InChIKey | ODBMZHVOEJEJDV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide?
The IUPAC name of N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide (CID 103890787) is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide?
The canonical SMILES for N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide is CCC(CO)(CO)NC(=O)c1oc(C)nc1C.
What is the InChIKey of N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide?
The InChIKey is ODBMZHVOEJEJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4/c1-4-11(5-14,6-15)13-10(16)9-7(2)12-8(3)17-9/h14-15H,4-6H2,1-3H3,(H,13,16).
What are the key properties of N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide?
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide has a molecular weight of 242.27 g/mol, XLogP of 0.15, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 103890787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).