C24H41NO5Si — CID 10389126
2-[(2R,4R,5R,6S)-6-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide (PubChem CID 10389126) has the molecular formula C24H41NO5Si and a molecular weight of 451.68 g/mol. Its IUPAC name is 2-[(2R,4R,5R,6S)-6-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[(2R,4R,5R,6S)-6-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 10389126 |
| Molecular Formula | C24H41NO5Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 2-[(2R,4R,5R,6S)-6-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)C[C@H]1O[C@@H](c2ccccc2)O[C@@H]([C@H](C)CO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C24H41NO5Si/c1-17(16-28-31(8,9)24(3,4)5)22-18(2)20(15-21(26)25(6)27-7)29-23(30-22)19-13-11-10-12-14-19/h10-14,17-18,20,22-23H,15-16H2,1-9H3/t17-,18-,20-,22+,23-/m1/s1 |
| InChIKey | VFHBKTMVASYCIK-YPBQMLHOSA-N |
| XLogP | 5.17 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|