C22H28O10 — CID 10389145
[(2R,3S,6S)-6-[5-[(2S,3R,6R)-3-acetyloxy-2-methyl-3,6-dihydro-2H-pyran-6-yl]-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]-2-methyl-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 10389145) has the molecular formula C22H28O10 and a molecular weight of 452.46 g/mol. Its IUPAC name is [(2R,3S,6S)-6-[5-[(2S,3R,6R)-3-acetyloxy-2-methyl-3,6-dihydro-2H-pyran-6-yl]-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]-2-methyl-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2R,3S,6S)-6-[5-[(2S,3R,6R)-3-acetyloxy-2-methyl-3,6-dihydro-2H-pyran-6-yl]-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]-2-methyl-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 10389145 |
| Molecular Formula | C22H28O10 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [(2R,3S,6S)-6-[5-[(2S,3R,6R)-3-acetyloxy-2-methyl-3,6-dihydro-2H-pyran-6-yl]-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]-2-methyl-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](C2([C@H]3C=C[C@@H](OC(C)=O)[C@H](C)O3)C(=O)OC(C)(C)OC2=O)O[C@@H]1C |
| InChI | InChI=1S/C22H28O10/c1-11-15(29-13(3)23)7-9-17(27-11)22(19(25)31-21(5,6)32-20(22)26)18-10-8-16(12(2)28-18)30-14(4)24/h7-12,15-18H,1-6H3/t11-,12+,15+,16-,17+,18- |
| InChIKey | KRNFREPYRXQCAV-PUQNQXMMSA-N |
| XLogP | 1.36 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|