C15H22N2O3 — CID 103892120
3,5-dihydroxy-N-(2-methyl-3-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 103892120) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(2-methyl-3-pyrrolidin-1-ylpropyl)benzamide.
| Compound Name | 3,5-dihydroxy-N-(2-methyl-3-pyrrolidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 103892120 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3,5-dihydroxy-N-(2-methyl-3-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | CC(CNC(=O)c1cc(O)cc(O)c1)CN1CCCC1 |
| InChI | InChI=1S/C15H22N2O3/c1-11(10-17-4-2-3-5-17)9-16-15(20)12-6-13(18)8-14(19)7-12/h6-8,11,18-19H,2-5,9-10H2,1H3,(H,16,20) |
| InChIKey | BNSICCIOFRPMLQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |