C14H22N2O3 — CID 103893143
N-[3-(dimethylamino)-2,2-dimethylpropyl]-3,5-dihydroxybenzamide (PubChem CID 103893143) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 103893143 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-3,5-dihydroxybenzamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-14(2,9-16(3)4)8-15-13(19)10-5-11(17)7-12(18)6-10/h5-7,17-18H,8-9H2,1-4H3,(H,15,19) |
| InChIKey | OEAOBTHCHXIOTJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |