C10H15F3N2O2 — CID 103893513
1-(5-methyl-1,3-oxazol-2-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine (PubChem CID 103893513) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 1-(5-methyl-1,3-oxazol-2-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine.
| Compound Name | 1-(5-methyl-1,3-oxazol-2-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 103893513 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-(5-methyl-1,3-oxazol-2-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
| SMILES | Cc1cnc(C(C)NCCOCC(F)(F)F)o1 |
| InChI | InChI=1S/C10H15F3N2O2/c1-7-5-15-9(17-7)8(2)14-3-4-16-6-10(11,12)13/h5,8,14H,3-4,6H2,1-2H3 |
| InChIKey | FSOQASXRFHQPEL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|