C25H48O5Si — CID 10389373
[(2Z)-2-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(1-ethoxyethoxy)-3-methylcyclohexylidene]ethyl] 2,2-dimethylpropanoate (PubChem CID 10389373) has the molecular formula C25H48O5Si and a molecular weight of 456.74 g/mol. Its IUPAC name is [(2Z)-2-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(1-ethoxyethoxy)-3-methylcyclohexylidene]ethyl] 2,2-dimethylpropanoate.
| Compound Name | [(2Z)-2-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(1-ethoxyethoxy)-3-methylcyclohexylidene]ethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10389373 |
| Molecular Formula | C25H48O5Si |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | [(2Z)-2-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(1-ethoxyethoxy)-3-methylcyclohexylidene]ethyl] 2,2-dimethylpropanoate |
| SMILES | CCOC(C)O[C@@H]1/C(=C\COC(=O)C(C)(C)C)CCC[C@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48O5Si/c1-12-27-19(2)30-21-20(15-17-28-22(26)23(3,4)5)14-13-16-25(21,9)18-29-31(10,11)24(6,7)8/h15,19,21H,12-14,16-18H2,1-11H3/b20-15-/t19?,21-,25-/m1/s1 |
| InChIKey | LUBPTXKDUJBUPO-SPUHLVPASA-N |
| XLogP | 6.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|