C8H8F3N5S — CID 103894466
N-[2-(trifluoromethylsulfanyl)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 103894466) has the molecular formula C8H8F3N5S and a molecular weight of 263.25 g/mol. Its IUPAC name is N-[2-(trifluoromethylsulfanyl)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-[2-(trifluoromethylsulfanyl)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 103894466 |
| Molecular Formula | C8H8F3N5S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | N-[2-(trifluoromethylsulfanyl)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | FC(F)(F)SCCNc1nccn2cnnc12 |
| InChI | InChI=1S/C8H8F3N5S/c9-8(10,11)17-4-2-13-6-7-15-14-5-16(7)3-1-12-6/h1,3,5H,2,4H2,(H,12,13) |
| InChIKey | FYVXEGZUMZDDEH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|