C27H30FN5O — CID 10389486
6-[3-(dimethylamino)propoxy]-2-N-(4-fluoro-2-methylphenyl)-4-N-methyl-4-N-phenylquinazoline-2,4-diamine (PubChem CID 10389486) has the molecular formula C27H30FN5O and a molecular weight of 459.57 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propoxy]-2-N-(4-fluoro-2-methylphenyl)-4-N-methyl-4-N-phenylquinazoline-2,4-diamine.
| Compound Name | 6-[3-(dimethylamino)propoxy]-2-N-(4-fluoro-2-methylphenyl)-4-N-methyl-4-N-phenylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 10389486 |
| Molecular Formula | C27H30FN5O |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 6-[3-(dimethylamino)propoxy]-2-N-(4-fluoro-2-methylphenyl)-4-N-methyl-4-N-phenylquinazoline-2,4-diamine |
| SMILES | Cc1cc(F)ccc1Nc1nc(N(C)c2ccccc2)c2cc(OCCCN(C)C)ccc2n1 |
| InChI | InChI=1S/C27H30FN5O/c1-19-17-20(28)11-13-24(19)29-27-30-25-14-12-22(34-16-8-15-32(2)3)18-23(25)26(31-27)33(4)21-9-6-5-7-10-21/h5-7,9-14,17-18H,8,15-16H2,1-4H3,(H,29,30,31) |
| InChIKey | FKLRFZZNODMAAU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|