C26H29N5OS — CID 10389493
4-[(E)-N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-C-methylcarbonimidoyl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 10389493) has the molecular formula C26H29N5OS and a molecular weight of 459.62 g/mol. Its IUPAC name is 4-[(E)-N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-C-methylcarbonimidoyl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(E)-N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-C-methylcarbonimidoyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 10389493 |
| Molecular Formula | C26H29N5OS |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 4-[(E)-N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-C-methylcarbonimidoyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CCCCn1c(-c2ccccc2)cs/c1=N/N=C(\C)c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C26H29N5OS/c1-5-6-17-30-23(21-13-9-7-10-14-21)18-33-26(30)28-27-19(2)24-20(3)29(4)31(25(24)32)22-15-11-8-12-16-22/h7-16,18H,5-6,17H2,1-4H3/b27-19+,28-26+ |
| InChIKey | HNMXHPMKJVDHDT-GPXOMEDASA-N |
| XLogP | 5.14 |
| TPSA | 56.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|