About 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane
2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane (PubChem CID 103895121) has the molecular formula C8H20N2O3S
and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane.
Molecular Properties
| Compound Name | 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane |
| PubChem CID | 103895121 |
| Molecular Formula | C8H20N2O3S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane |
| SMILES | CN(C)S(=O)(=O)NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C8H20N2O3S/c1-7(2,8(3,4)11)9-14(12,13)10(5)6/h9,11H,1-6H3 |
| InChIKey | NIGDNXGOMBNDRG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane?
The IUPAC name of 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane (CID 103895121) is 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane.
What is the SMILES notation for 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane?
The canonical SMILES for 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane is CN(C)S(=O)(=O)NC(C)(C)C(C)(C)O.
What is the InChIKey of 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane?
The InChIKey is NIGDNXGOMBNDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O3S/c1-7(2,8(3,4)11)9-14(12,13)10(5)6/h9,11H,1-6H3.
What are the key properties of 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane?
2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane has a molecular weight of 224.33 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane is sourced from PubChem (CID 103895121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).