About (3-methyloxan-3-yl)urea
(3-methyloxan-3-yl)urea (PubChem CID 103895709) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is (3-methyloxan-3-yl)urea.
Molecular Properties
| Compound Name | (3-methyloxan-3-yl)urea |
| PubChem CID | 103895709 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (3-methyloxan-3-yl)urea |
| SMILES | CC1(NC(N)=O)CCCOC1 |
| InChI | InChI=1S/C7H14N2O2/c1-7(9-6(8)10)3-2-4-11-5-7/h2-5H2,1H3,(H3,8,9,10) |
| InChIKey | RZTLHEVZJIXEPY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methyloxan-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxan-3-yl)urea?
The IUPAC name of (3-methyloxan-3-yl)urea (CID 103895709) is (3-methyloxan-3-yl)urea.
What is the SMILES notation for (3-methyloxan-3-yl)urea?
The canonical SMILES for (3-methyloxan-3-yl)urea is CC1(NC(N)=O)CCCOC1.
What is the InChIKey of (3-methyloxan-3-yl)urea?
The InChIKey is RZTLHEVZJIXEPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-7(9-6(8)10)3-2-4-11-5-7/h2-5H2,1H3,(H3,8,9,10).
What are the key properties of (3-methyloxan-3-yl)urea?
(3-methyloxan-3-yl)urea has a molecular weight of 158.20 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxan-3-yl)urea is sourced from PubChem (CID 103895709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).