C29H23N3O3 — CID 10389580
2-[4-[(4-methoxybenzoyl)amino]phenyl]-N-phenyl-1H-indole-5-carboxamide (PubChem CID 10389580) has the molecular formula C29H23N3O3 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-[4-[(4-methoxybenzoyl)amino]phenyl]-N-phenyl-1H-indole-5-carboxamide.
| Compound Name | 2-[4-[(4-methoxybenzoyl)amino]phenyl]-N-phenyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 10389580 |
| Molecular Formula | C29H23N3O3 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-[4-[(4-methoxybenzoyl)amino]phenyl]-N-phenyl-1H-indole-5-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3cc4cc(C(=O)Nc5ccccc5)ccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C29H23N3O3/c1-35-25-14-9-20(10-15-25)28(33)31-24-12-7-19(8-13-24)27-18-22-17-21(11-16-26(22)32-27)29(34)30-23-5-3-2-4-6-23/h2-18,32H,1H3,(H,30,34)(H,31,33) |
| InChIKey | CNAPPACCYNLPOF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |