C27H34N4OS — CID 10389636
N-[4-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]butyl]-4-phenylbenzamide (PubChem CID 10389636) has the molecular formula C27H34N4OS and a molecular weight of 462.66 g/mol. Its IUPAC name is N-[4-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]butyl]-4-phenylbenzamide.
| Compound Name | N-[4-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]butyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 10389636 |
| Molecular Formula | C27H34N4OS |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[4-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]butyl]-4-phenylbenzamide |
| SMILES | CCCN(CCCCNC(=O)c1ccc(-c2ccccc2)cc1)C1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C27H34N4OS/c1-2-17-31(23-14-15-24-25(19-23)33-27(28)30-24)18-7-6-16-29-26(32)22-12-10-21(11-13-22)20-8-4-3-5-9-20/h3-5,8-13,23H,2,6-7,14-19H2,1H3,(H2,28,30)(H,29,32) |
| InChIKey | YDIIMEYIGWYMMA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|