C15H23NO3S — CID 103896846
4-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperidin-3-ol (PubChem CID 103896846) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperidin-3-ol.
| Compound Name | 4-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 103896846 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperidin-3-ol |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(C)C(O)C2)c(C)c1 |
| InChI | InChI=1S/C15H23NO3S/c1-10-7-12(3)15(13(4)8-10)20(18,19)16-6-5-11(2)14(17)9-16/h7-8,11,14,17H,5-6,9H2,1-4H3 |
| InChIKey | PZBSRGQCFKALSB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |