C15H25NO2 — CID 103897679
5-[(3-methoxyphenyl)methylamino]-4,4-dimethylpentan-1-ol (PubChem CID 103897679) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 5-[(3-methoxyphenyl)methylamino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[(3-methoxyphenyl)methylamino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 103897679 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 5-[(3-methoxyphenyl)methylamino]-4,4-dimethylpentan-1-ol |
| SMILES | COc1cccc(CNCC(C)(C)CCCO)c1 |
| InChI | InChI=1S/C15H25NO2/c1-15(2,8-5-9-17)12-16-11-13-6-4-7-14(10-13)18-3/h4,6-7,10,16-17H,5,8-9,11-12H2,1-3H3 |
| InChIKey | GCSAFLKBZMYNOH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |