C22H27F2N3O4S — CID 10389855
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl)amino]-3-hydroxybutan-2-yl]acetamide (PubChem CID 10389855) has the molecular formula C22H27F2N3O4S and a molecular weight of 467.54 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl)amino]-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl)amino]-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 10389855 |
| Molecular Formula | C22H27F2N3O4S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl)amino]-3-hydroxybutan-2-yl]acetamide |
| SMILES | CCc1ccc2c(c1)C(NC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O)CS(=O)(=O)N2 |
| InChI | InChI=1S/C22H27F2N3O4S/c1-3-14-4-5-19-18(8-14)21(12-32(30,31)27-19)25-11-22(29)20(26-13(2)28)9-15-6-16(23)10-17(24)7-15/h4-8,10,20-22,25,27,29H,3,9,11-12H2,1-2H3,(H,26,28)/t20-,21?,22+/m0/s1 |
| InChIKey | SXJLKMADXQDEDA-JAFNVKOHSA-N |
| XLogP | 2.02 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |