C24H41NO6Si — CID 10389865
[(4R,4aS,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-4a-yl]methyl 2-cyanoacetate (PubChem CID 10389865) has the molecular formula C24H41NO6Si and a molecular weight of 467.68 g/mol. Its IUPAC name is [(4R,4aS,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-4a-yl]methyl 2-cyanoacetate.
| Compound Name | [(4R,4aS,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-4a-yl]methyl 2-cyanoacetate |
|---|---|
| PubChem CID | 10389865 |
| Molecular Formula | C24H41NO6Si |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | [(4R,4aS,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-4a-yl]methyl 2-cyanoacetate |
| SMILES | COCCOCO[C@@H]1CCC[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C=C[C@]21COC(=O)CC#N |
| InChI | InChI=1S/C24H41NO6Si/c1-23(2,3)32(5,6)31-20-10-12-24(17-29-22(26)11-13-25)19(16-20)8-7-9-21(24)30-18-28-15-14-27-4/h10,12,19-21H,7-9,11,14-18H2,1-6H3/t19-,20-,21-,24+/m1/s1 |
| InChIKey | BTARJHGUUJRNAN-CTVDGRRTSA-N |
| XLogP | 4.59 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|