C28H24N2O5 — CID 10389882
[10-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-yl]methyl acetate (PubChem CID 10389882) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is [10-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-yl]methyl acetate.
| Compound Name | [10-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-yl]methyl acetate |
|---|---|
| PubChem CID | 10389882 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [10-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-yl]methyl acetate |
| SMILES | CC(=O)OCC1CCn2c(c(C3=C(c4cn(C)c5ccccc45)C(=O)OC3=O)c3ccccc32)C1 |
| InChI | InChI=1S/C28H24N2O5/c1-16(31)34-15-17-11-12-30-22-10-6-4-8-19(22)24(23(30)13-17)26-25(27(32)35-28(26)33)20-14-29(2)21-9-5-3-7-18(20)21/h3-10,14,17H,11-13,15H2,1-2H3 |
| InChIKey | KOSNJXYHVARSMD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|