C12H23NO2 — CID 103899591
N-(5-hydroxy-2,2-dimethylpentyl)-3-methylbut-2-enamide (PubChem CID 103899591) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(5-hydroxy-2,2-dimethylpentyl)-3-methylbut-2-enamide.
| Compound Name | N-(5-hydroxy-2,2-dimethylpentyl)-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 103899591 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-(5-hydroxy-2,2-dimethylpentyl)-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)NCC(C)(C)CCCO |
| InChI | InChI=1S/C12H23NO2/c1-10(2)8-11(15)13-9-12(3,4)6-5-7-14/h8,14H,5-7,9H2,1-4H3,(H,13,15) |
| InChIKey | FDHAXCDVDRIXMJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|