C28H26N2O5 — CID 10389981
2-[3-[(2-benzylphenyl)methyl]-2-ethyl-1-oxamoylindolizin-8-yl]oxyacetic acid (PubChem CID 10389981) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[3-[(2-benzylphenyl)methyl]-2-ethyl-1-oxamoylindolizin-8-yl]oxyacetic acid.
| Compound Name | 2-[3-[(2-benzylphenyl)methyl]-2-ethyl-1-oxamoylindolizin-8-yl]oxyacetic acid |
|---|---|
| PubChem CID | 10389981 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-[3-[(2-benzylphenyl)methyl]-2-ethyl-1-oxamoylindolizin-8-yl]oxyacetic acid |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)O)cccn2c1Cc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C28H26N2O5/c1-2-21-22(16-20-12-7-6-11-19(20)15-18-9-4-3-5-10-18)30-14-8-13-23(35-17-24(31)32)26(30)25(21)27(33)28(29)34/h3-14H,2,15-17H2,1H3,(H2,29,34)(H,31,32) |
| InChIKey | LNIJDTKDAASOIT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|