C22H19BrN2O5 — CID 10390010
ethyl 2-[6-bromo-2-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-2H-quinolin-1-yl]-2-oxoacetate (PubChem CID 10390010) has the molecular formula C22H19BrN2O5 and a molecular weight of 471.31 g/mol. Its IUPAC name is ethyl 2-[6-bromo-2-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-2H-quinolin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[6-bromo-2-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-2H-quinolin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 10390010 |
| Molecular Formula | C22H19BrN2O5 |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | ethyl 2-[6-bromo-2-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-2H-quinolin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1c2ccc(Br)cc2CCC1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H19BrN2O5/c1-2-30-22(29)21(28)25-15(9-7-13-11-14(23)8-10-18(13)25)12-24-19(26)16-5-3-4-6-17(16)20(24)27/h3-6,8,10-11,15H,2,7,9,12H2,1H3 |
| InChIKey | JYICPMWHLMLYNZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|