C13H16Cl2N2O2 — CID 103901173
(4-amino-3,5-dichlorophenyl)-(3-hydroxy-4-methylpiperidin-1-yl)methanone (PubChem CID 103901173) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-(3-hydroxy-4-methylpiperidin-1-yl)methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-(3-hydroxy-4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 103901173 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-(3-hydroxy-4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2cc(Cl)c(N)c(Cl)c2)CC1O |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-7-2-3-17(6-11(7)18)13(19)8-4-9(14)12(16)10(15)5-8/h4-5,7,11,18H,2-3,6,16H2,1H3 |
| InChIKey | SARZIYZQENIYGD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|