C24H25ClO8 — CID 10390265
(8E,13S)-16-chloro-3,4,5,17,18,19-hexamethoxy-11-oxatetracyclo[13.4.0.02,7.09,13]nonadeca-1(15),2,4,6,8,16,18-heptaen-10-one (PubChem CID 10390265) has the molecular formula C24H25ClO8 and a molecular weight of 476.91 g/mol. Its IUPAC name is (8E,13S)-16-chloro-3,4,5,17,18,19-hexamethoxy-11-oxatetracyclo[13.4.0.02,7.09,13]nonadeca-1(15),2,4,6,8,16,18-heptaen-10-one.
| Compound Name | (8E,13S)-16-chloro-3,4,5,17,18,19-hexamethoxy-11-oxatetracyclo[13.4.0.02,7.09,13]nonadeca-1(15),2,4,6,8,16,18-heptaen-10-one |
|---|---|
| PubChem CID | 10390265 |
| Molecular Formula | C24H25ClO8 |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | (8E,13S)-16-chloro-3,4,5,17,18,19-hexamethoxy-11-oxatetracyclo[13.4.0.02,7.09,13]nonadeca-1(15),2,4,6,8,16,18-heptaen-10-one |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(c(Cl)c(OC)c(OC)c1OC)C[C@@H]1COC(=O)/C1=C/2 |
| InChI | InChI=1S/C24H25ClO8/c1-27-15-9-11-7-13-12(10-33-24(13)26)8-14-17(16(11)20(29-3)19(15)28-2)21(30-4)23(32-6)22(31-5)18(14)25/h7,9,12H,8,10H2,1-6H3/b13-7+/t12-/m1/s1 |
| InChIKey | BONRSAYSVXIVOU-GKWYLQRDSA-N |
| XLogP | 4.17 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |