C15H21NS — CID 103903628
N-[1-(4-methylsulfanylphenyl)ethyl]hex-5-yn-1-amine (PubChem CID 103903628) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is N-[1-(4-methylsulfanylphenyl)ethyl]hex-5-yn-1-amine.
| Compound Name | N-[1-(4-methylsulfanylphenyl)ethyl]hex-5-yn-1-amine |
|---|---|
| PubChem CID | 103903628 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-[1-(4-methylsulfanylphenyl)ethyl]hex-5-yn-1-amine |
| SMILES | C#CCCCCNC(C)c1ccc(SC)cc1 |
| InChI | InChI=1S/C15H21NS/c1-4-5-6-7-12-16-13(2)14-8-10-15(17-3)11-9-14/h1,8-11,13,16H,5-7,12H2,2-3H3 |
| InChIKey | UYPGWGQMGUDZRI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|