C21H26FN5O5S — CID 10390375
4-[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propylcarbamoyl]benzenesulfonyl fluoride (PubChem CID 10390375) has the molecular formula C21H26FN5O5S and a molecular weight of 479.53 g/mol. Its IUPAC name is 4-[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propylcarbamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propylcarbamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 10390375 |
| Molecular Formula | C21H26FN5O5S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 4-[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propylcarbamoyl]benzenesulfonyl fluoride |
| SMILES | CCCn1c(=O)c2[nH]c(CCCNC(=O)c3ccc(S(=O)(=O)F)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C21H26FN5O5S/c1-3-12-26-18-17(20(29)27(13-4-2)21(26)30)24-16(25-18)6-5-11-23-19(28)14-7-9-15(10-8-14)33(22,31)32/h7-10H,3-6,11-13H2,1-2H3,(H,23,28)(H,24,25) |
| InChIKey | NTTROYHIODZBSX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|