C14H27NO2 — CID 103904981
N-(2-but-3-enoxyethyl)-2,2,5,5-tetramethyloxolan-3-amine (PubChem CID 103904981) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-2,2,5,5-tetramethyloxolan-3-amine.
| Compound Name | N-(2-but-3-enoxyethyl)-2,2,5,5-tetramethyloxolan-3-amine |
|---|---|
| PubChem CID | 103904981 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-2,2,5,5-tetramethyloxolan-3-amine |
| SMILES | C=CCCOCCNC1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C14H27NO2/c1-6-7-9-16-10-8-15-12-11-13(2,3)17-14(12,4)5/h6,12,15H,1,7-11H2,2-5H3 |
| InChIKey | SJVQBGDRADWPGE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|