C13H26N2O — CID 103905016
N-(2-but-3-enoxyethyl)-1,2-dimethylpiperidin-4-amine (PubChem CID 103905016) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-1,2-dimethylpiperidin-4-amine.
| Compound Name | N-(2-but-3-enoxyethyl)-1,2-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 103905016 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-1,2-dimethylpiperidin-4-amine |
| SMILES | C=CCCOCCNC1CCN(C)C(C)C1 |
| InChI | InChI=1S/C13H26N2O/c1-4-5-9-16-10-7-14-13-6-8-15(3)12(2)11-13/h4,12-14H,1,5-11H2,2-3H3 |
| InChIKey | GLUDVESBFDFCAT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|