C11H14ClN3S — CID 103905092
1-(5-chlorothiophen-2-yl)-N-[1-(1H-pyrazol-4-yl)ethyl]ethanamine (PubChem CID 103905092) has the molecular formula C11H14ClN3S and a molecular weight of 255.77 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-[1-(1H-pyrazol-4-yl)ethyl]ethanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-[1-(1H-pyrazol-4-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 103905092 |
| Molecular Formula | C11H14ClN3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-[1-(1H-pyrazol-4-yl)ethyl]ethanamine |
| SMILES | CC(NC(C)c1ccc(Cl)s1)c1cn[nH]c1 |
| InChI | InChI=1S/C11H14ClN3S/c1-7(9-5-13-14-6-9)15-8(2)10-3-4-11(12)16-10/h3-8,15H,1-2H3,(H,13,14) |
| InChIKey | SEMOXJLEKJUKSC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |