C15H24ClNO — CID 103905460
5-[1-(4-chlorophenyl)propylamino]-2-methylpentan-1-ol (PubChem CID 103905460) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)propylamino]-2-methylpentan-1-ol.
| Compound Name | 5-[1-(4-chlorophenyl)propylamino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 103905460 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 5-[1-(4-chlorophenyl)propylamino]-2-methylpentan-1-ol |
| SMILES | CCC(NCCCC(C)CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H24ClNO/c1-3-15(13-6-8-14(16)9-7-13)17-10-4-5-12(2)11-18/h6-9,12,15,17-18H,3-5,10-11H2,1-2H3 |
| InChIKey | KEIYKZPVSLXFAC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|