C14H23N — CID 103905893
(1S)-N-but-2-ynyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine (PubChem CID 103905893) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (1S)-N-but-2-ynyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1S)-N-but-2-ynyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 103905893 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (1S)-N-but-2-ynyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CC#CCNC1CC2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C14H23N/c1-5-6-9-15-12-10-11-7-8-14(12,4)13(11,2)3/h11-12,15H,7-10H2,1-4H3/t11?,12?,14-/m1/s1 |
| InChIKey | GNNKZPAQNFRUBT-ORHYLEIMSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|