C20H17FN8O4S — CID 10390605
4-[[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride (PubChem CID 10390605) has the molecular formula C20H17FN8O4S and a molecular weight of 484.47 g/mol. Its IUPAC name is 4-[[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride.
| Compound Name | 4-[[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 10390605 |
| Molecular Formula | C20H17FN8O4S |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 4-[[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride |
| SMILES | CCCn1cc2c(nc(NC(=O)Nc3ccc(S(=O)(=O)F)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C20H17FN8O4S/c1-2-9-28-11-14-16(26-28)24-19(29-18(14)23-17(27-29)15-4-3-10-33-15)25-20(30)22-12-5-7-13(8-6-12)34(21,31)32/h3-8,10-11H,2,9H2,1H3,(H2,22,24,25,26,30) |
| InChIKey | XOLUPBLUZGIGNN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |