C10H17NOS — CID 103906827
(2R)-1-[1-(5-methylthiophen-2-yl)ethylamino]propan-2-ol (PubChem CID 103906827) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is (2R)-1-[1-(5-methylthiophen-2-yl)ethylamino]propan-2-ol.
| Compound Name | (2R)-1-[1-(5-methylthiophen-2-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 103906827 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (2R)-1-[1-(5-methylthiophen-2-yl)ethylamino]propan-2-ol |
| SMILES | Cc1ccc(C(C)NC[C@@H](C)O)s1 |
| InChI | InChI=1S/C10H17NOS/c1-7(12)6-11-9(3)10-5-4-8(2)13-10/h4-5,7,9,11-12H,6H2,1-3H3/t7-,9?/m1/s1 |
| InChIKey | PWXCEMWUPDXHLM-YOXFSPIKSA-N |
| XLogP | 2.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |