About 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one
1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one (PubChem CID 103907696) has the molecular formula C10H13N5O2
and a molecular weight of 235.25 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one |
| PubChem CID | 103907696 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one |
| SMILES | CCn1ccnc(NCCc2ncno2)c1=O |
| InChI | InChI=1S/C10H13N5O2/c1-2-15-6-5-12-9(10(15)16)11-4-3-8-13-7-14-17-8/h5-7H,2-4H2,1H3,(H,11,12) |
| InChIKey | QOZZNLFNNPBONM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one?
The IUPAC name of 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one (CID 103907696) is 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one.
What is the SMILES notation for 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one?
The canonical SMILES for 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one is CCn1ccnc(NCCc2ncno2)c1=O.
What is the InChIKey of 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one?
The InChIKey is QOZZNLFNNPBONM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O2/c1-2-15-6-5-12-9(10(15)16)11-4-3-8-13-7-14-17-8/h5-7H,2-4H2,1H3,(H,11,12).
What are the key properties of 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one?
1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one has a molecular weight of 235.25 g/mol, XLogP of 0.30, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyrazin-2-one is sourced from PubChem (CID 103907696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).