C33H34N2O2 — CID 10390876
4-[7,7,10,10-tetramethyl-1-(pyridin-2-ylmethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid (PubChem CID 10390876) has the molecular formula C33H34N2O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 4-[7,7,10,10-tetramethyl-1-(pyridin-2-ylmethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid.
| Compound Name | 4-[7,7,10,10-tetramethyl-1-(pyridin-2-ylmethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 10390876 |
| Molecular Formula | C33H34N2O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 4-[7,7,10,10-tetramethyl-1-(pyridin-2-ylmethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)CCc1c(-c2ccc(C(=O)O)cc2)cn(Cc2ccccn2)c1-3 |
| InChI | InChI=1S/C33H34N2O2/c1-32(2)14-15-33(3,4)29-18-26-23(17-28(29)32)12-13-25-27(21-8-10-22(11-9-21)31(36)37)20-35(30(25)26)19-24-7-5-6-16-34-24/h5-11,16-18,20H,12-15,19H2,1-4H3,(H,36,37) |
| InChIKey | GPYPWVQJBUXWOW-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |