About trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane
trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane (PubChem CID 10390978) has the molecular formula C16H30Br2O2Se
and a molecular weight of 493.18 g/mol. Its IUPAC name is trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane.
Molecular Properties
| Compound Name | trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane |
| PubChem CID | 10390978 |
| Molecular Formula | C16H30Br2O2Se |
| Molecular Weight | 493.18 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane |
| SMILES | CCO[C@H]1CCCC[C@@H]1[Se](Br)(Br)[C@@H]1CCCC[C@H]1OCC |
| InChI | InChI=1S/C16H30Br2O2Se/c1-3-19-13-9-5-7-11-15(13)21(17,18)16-12-8-6-10-14(16)20-4-2/h13-16H,3-12H2,1-2H3/t13-,14+,15-,16+ |
| InChIKey | UCICCHIZLPEYAC-GEEKYZPCSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.18 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane?
The IUPAC name of trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane (CID 10390978) is trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane.
What is the SMILES notation for trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane?
The canonical SMILES for trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane is CCO[C@H]1CCCC[C@@H]1[Se](Br)(Br)[C@@H]1CCCC[C@H]1OCC.
What is the InChIKey of trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane?
The InChIKey is UCICCHIZLPEYAC-GEEKYZPCSA-N. The full InChI is InChI=1S/C16H30Br2O2Se/c1-3-19-13-9-5-7-11-15(13)21(17,18)16-12-8-6-10-14(16)20-4-2/h13-16H,3-12H2,1-2H3/t13-,14+,15-,16+.
What are the key properties of trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane?
trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane has a molecular weight of 493.18 g/mol, XLogP of 5.92, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-ethoxycyclohexyl]-lambda4-selanyl]-2-ethoxycyclohexane is sourced from PubChem (CID 10390978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).