C23H23F3N2O7 — CID 10391104
N-[(2S,3S,4S,6S)-6-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]oxy]-2-methyl-3-(4-nitrophenoxy)oxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 10391104) has the molecular formula C23H23F3N2O7 and a molecular weight of 496.44 g/mol. Its IUPAC name is N-[(2S,3S,4S,6S)-6-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]oxy]-2-methyl-3-(4-nitrophenoxy)oxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3S,4S,6S)-6-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]oxy]-2-methyl-3-(4-nitrophenoxy)oxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10391104 |
| Molecular Formula | C23H23F3N2O7 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-[(2S,3S,4S,6S)-6-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]oxy]-2-methyl-3-(4-nitrophenoxy)oxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2OCCc3ccccc32)C[C@H](NC(=O)C(F)(F)F)[C@@H]1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H23F3N2O7/c1-13-20(34-16-8-6-15(7-9-16)28(30)31)18(27-22(29)23(24,25)26)12-19(33-13)35-21-17-5-3-2-4-14(17)10-11-32-21/h2-9,13,18-21H,10-12H2,1H3,(H,27,29)/t13-,18-,19-,20+,21-/m0/s1 |
| InChIKey | NGYHURKMKNOULG-QNZPNERBSA-N |
| XLogP | 3.81 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|