C29H36O5S — CID 10391138
methyl 4-[2,2-dimethoxy-1-(6,6,9,9-tetramethyl-4-oxo-2,3,7,8-tetrahydrobenzo[g]thiochromen-3-yl)ethyl]benzoate (PubChem CID 10391138) has the molecular formula C29H36O5S and a molecular weight of 496.67 g/mol. Its IUPAC name is methyl 4-[2,2-dimethoxy-1-(6,6,9,9-tetramethyl-4-oxo-2,3,7,8-tetrahydrobenzo[g]thiochromen-3-yl)ethyl]benzoate.
| Compound Name | methyl 4-[2,2-dimethoxy-1-(6,6,9,9-tetramethyl-4-oxo-2,3,7,8-tetrahydrobenzo[g]thiochromen-3-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 10391138 |
| Molecular Formula | C29H36O5S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | methyl 4-[2,2-dimethoxy-1-(6,6,9,9-tetramethyl-4-oxo-2,3,7,8-tetrahydrobenzo[g]thiochromen-3-yl)ethyl]benzoate |
| SMILES | COC(=O)c1ccc(C(C(OC)OC)C2CSc3cc4c(cc3C2=O)C(C)(C)CCC4(C)C)cc1 |
| InChI | InChI=1S/C29H36O5S/c1-28(2)12-13-29(3,4)22-15-23-19(14-21(22)28)25(30)20(16-35-23)24(27(33-6)34-7)17-8-10-18(11-9-17)26(31)32-5/h8-11,14-15,20,24,27H,12-13,16H2,1-7H3 |
| InChIKey | RGVIXBWQEXRMNT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|