C16H21N3O2 — CID 103914795
2-[[1-(oxan-4-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 103914795) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[[1-(oxan-4-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[1-(oxan-4-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 103914795 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[[1-(oxan-4-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC(NCc1cc(=O)n2ccccc2n1)C1CCOCC1 |
| InChI | InChI=1S/C16H21N3O2/c1-12(13-5-8-21-9-6-13)17-11-14-10-16(20)19-7-3-2-4-15(19)18-14/h2-4,7,10,12-13,17H,5-6,8-9,11H2,1H3 |
| InChIKey | LNUPTBLQLBTKGL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |