C12H21N3O3S — CID 103914964
3,5-dimethyl-N-[1-(oxan-4-yl)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 103914964) has the molecular formula C12H21N3O3S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3,5-dimethyl-N-[1-(oxan-4-yl)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[1-(oxan-4-yl)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 103914964 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3,5-dimethyl-N-[1-(oxan-4-yl)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NC(C)C1CCOCC1 |
| InChI | InChI=1S/C12H21N3O3S/c1-8(11-4-6-18-7-5-11)15-19(16,17)12-9(2)13-14-10(12)3/h8,11,15H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | LCRAKDICUPPLET-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |