C7H11F4NO3 — CID 103915330
2,2,3,3-tetrafluoro-N,N-bis(2-hydroxyethyl)propanamide (PubChem CID 103915330) has the molecular formula C7H11F4NO3 and a molecular weight of 233.16 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N,N-bis(2-hydroxyethyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N,N-bis(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 103915330 |
| Molecular Formula | C7H11F4NO3 |
| Molecular Weight | 233.16 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N,N-bis(2-hydroxyethyl)propanamide |
| SMILES | O=C(N(CCO)CCO)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H11F4NO3/c8-5(9)7(10,11)6(15)12(1-3-13)2-4-14/h5,13-14H,1-4H2 |
| InChIKey | UMLRRECTPURNSR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.16 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|