C10H15F3N2O3S — CID 103915356
N-(2-hydroxyethyl)-3-(2-oxo-1,3-thiazolidin-3-yl)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 103915356) has the molecular formula C10H15F3N2O3S and a molecular weight of 300.30 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-(2-oxo-1,3-thiazolidin-3-yl)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | N-(2-hydroxyethyl)-3-(2-oxo-1,3-thiazolidin-3-yl)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 103915356 |
| Molecular Formula | C10H15F3N2O3S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-(2-hydroxyethyl)-3-(2-oxo-1,3-thiazolidin-3-yl)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | O=C(CCN1CCSC1=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O3S/c11-10(12,13)7-15(3-5-16)8(17)1-2-14-4-6-19-9(14)18/h16H,1-7H2 |
| InChIKey | DWFXUNDXPFWGDA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|