C8H11F3N2O3S — CID 103915375
N-(2-hydroxyethyl)-2-oxo-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 103915375) has the molecular formula C8H11F3N2O3S and a molecular weight of 272.25 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-oxo-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-2-oxo-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 103915375 |
| Molecular Formula | C8H11F3N2O3S |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-(2-hydroxyethyl)-2-oxo-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)N(CCO)CC(F)(F)F)CS1 |
| InChI | InChI=1S/C8H11F3N2O3S/c9-8(10,11)4-13(1-2-14)6(15)5-3-17-7(16)12-5/h5,14H,1-4H2,(H,12,16) |
| InChIKey | OIAHHDKBHODOLL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|